C22H23F3N2O3 — CID 10273632
8-[2-[phenyl-(3,4,5-trifluorophenyl)methoxy]ethyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one (PubChem CID 10273632) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is 8-[2-[phenyl-(3,4,5-trifluorophenyl)methoxy]ethyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one.
| Compound Name | 8-[2-[phenyl-(3,4,5-trifluorophenyl)methoxy]ethyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 10273632 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 8-[2-[phenyl-(3,4,5-trifluorophenyl)methoxy]ethyl]-1-oxa-3,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1NCC2(CCN(CCOC(c3ccccc3)c3cc(F)c(F)c(F)c3)CC2)O1 |
| InChI | InChI=1S/C22H23F3N2O3/c23-17-12-16(13-18(24)19(17)25)20(15-4-2-1-3-5-15)29-11-10-27-8-6-22(7-9-27)14-26-21(28)30-22/h1-5,12-13,20H,6-11,14H2,(H,26,28) |
| InChIKey | SXASXAGVGJLESH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|