About N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide
N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide (PubChem CID 102736501) has the molecular formula C10H20N4O
and a molecular weight of 212.30 g/mol. Its IUPAC name is N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide.
Molecular Properties
| Compound Name | N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide |
| PubChem CID | 102736501 |
| Molecular Formula | C10H20N4O |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide |
| SMILES | C/N=C(\N)N1CCC(CNC(C)=O)CC1 |
| InChI | InChI=1S/C10H20N4O/c1-8(15)13-7-9-3-5-14(6-4-9)10(11)12-2/h9H,3-7H2,1-2H3,(H2,11,12)(H,13,15) |
| InChIKey | JKZWDEWOYHTFOA-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide?
The IUPAC name of N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide (CID 102736501) is N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide.
What is the SMILES notation for N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide?
The canonical SMILES for N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide is C/N=C(\N)N1CCC(CNC(C)=O)CC1.
What is the InChIKey of N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide?
The InChIKey is JKZWDEWOYHTFOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N4O/c1-8(15)13-7-9-3-5-14(6-4-9)10(11)12-2/h9H,3-7H2,1-2H3,(H2,11,12)(H,13,15).
What are the key properties of N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide?
N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide has a molecular weight of 212.30 g/mol, XLogP of -0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[1-(N'-methylcarbamimidoyl)piperidin-4-yl]methyl]acetamide is sourced from PubChem (CID 102736501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).