C24H28N4O3 — CID 10273657
N-[(1R,2S)-2-(hydroxycarbamoyl)cyclopentyl]-4-[(2-propan-2-ylbenzimidazol-1-yl)methyl]benzamide (PubChem CID 10273657) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is N-[(1R,2S)-2-(hydroxycarbamoyl)cyclopentyl]-4-[(2-propan-2-ylbenzimidazol-1-yl)methyl]benzamide.
| Compound Name | N-[(1R,2S)-2-(hydroxycarbamoyl)cyclopentyl]-4-[(2-propan-2-ylbenzimidazol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 10273657 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | N-[(1R,2S)-2-(hydroxycarbamoyl)cyclopentyl]-4-[(2-propan-2-ylbenzimidazol-1-yl)methyl]benzamide |
| SMILES | CC(C)c1nc2ccccc2n1Cc1ccc(C(=O)N[C@@H]2CCC[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-15(2)22-25-20-7-3-4-9-21(20)28(22)14-16-10-12-17(13-11-16)23(29)26-19-8-5-6-18(19)24(30)27-31/h3-4,7,9-13,15,18-19,31H,5-6,8,14H2,1-2H3,(H,26,29)(H,27,30)/t18-,19+/m0/s1 |
| InChIKey | XNUPVUIWOKTWNU-RBUKOAKNSA-N |
| XLogP | 3.61 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|