About 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one
2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one (PubChem CID 102737324) has the molecular formula C9H15NO3S
and a molecular weight of 217.29 g/mol. Its IUPAC name is 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one.
Molecular Properties
| Compound Name | 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one |
| PubChem CID | 102737324 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one |
| SMILES | O=C1CCC2(CCCS(=O)(=O)C2)CN1 |
| InChI | InChI=1S/C9H15NO3S/c11-8-2-4-9(6-10-8)3-1-5-14(12,13)7-9/h1-7H2,(H,10,11) |
| InChIKey | BUQVSQAXMAFBHJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one?
The IUPAC name of 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one (CID 102737324) is 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one.
What is the SMILES notation for 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one?
The canonical SMILES for 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one is O=C1CCC2(CCCS(=O)(=O)C2)CN1.
What is the InChIKey of 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one?
The InChIKey is BUQVSQAXMAFBHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3S/c11-8-2-4-9(6-10-8)3-1-5-14(12,13)7-9/h1-7H2,(H,10,11).
What are the key properties of 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one?
2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one has a molecular weight of 217.29 g/mol, XLogP of 0.09, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one is sourced from PubChem (CID 102737324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).