C9H15NO3S — CID 102737324
2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one (PubChem CID 102737324) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one.
| Compound Name | 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one |
|---|---|
| PubChem CID | 102737324 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 2,2-dioxo-2λ6-thia-8-azaspiro[5.5]undecan-9-one |
| SMILES | O=C1CCC2(CCCS(=O)(=O)C2)CN1 |
| InChI | InChI=1S/C9H15NO3S/c11-8-2-4-9(6-10-8)3-1-5-14(12,13)7-9/h1-7H2,(H,10,11) |
| InChIKey | BUQVSQAXMAFBHJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |