About 1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one
1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one (PubChem CID 102738612) has the molecular formula C9H14N4O2
and a molecular weight of 210.24 g/mol. Its IUPAC name is 1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one |
| PubChem CID | 102738612 |
| Molecular Formula | C9H14N4O2 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one |
| SMILES | CC(C(=O)N1CCCCO1)n1cncn1 |
| InChI | InChI=1S/C9H14N4O2/c1-8(12-7-10-6-11-12)9(14)13-4-2-3-5-15-13/h6-8H,2-5H2,1H3 |
| InChIKey | NXOZVEMZHYNPAR-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one?
The IUPAC name of 1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one (CID 102738612) is 1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one.
What is the SMILES notation for 1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one?
The canonical SMILES for 1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one is CC(C(=O)N1CCCCO1)n1cncn1.
What is the InChIKey of 1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one?
The InChIKey is NXOZVEMZHYNPAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O2/c1-8(12-7-10-6-11-12)9(14)13-4-2-3-5-15-13/h6-8H,2-5H2,1H3.
What are the key properties of 1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one?
1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one has a molecular weight of 210.24 g/mol, XLogP of 0.39, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxazinan-2-yl)-2-(1,2,4-triazol-1-yl)propan-1-one is sourced from PubChem (CID 102738612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).