C10H10N4O3 — CID 102739312
4-amino-3-hydroxy-N-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide (PubChem CID 102739312) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 4-amino-3-hydroxy-N-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide.
| Compound Name | 4-amino-3-hydroxy-N-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 102739312 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-amino-3-hydroxy-N-(5-methyl-1,3,4-oxadiazol-2-yl)benzamide |
| SMILES | Cc1nnc(NC(=O)c2ccc(N)c(O)c2)o1 |
| InChI | InChI=1S/C10H10N4O3/c1-5-13-14-10(17-5)12-9(16)6-2-3-7(11)8(15)4-6/h2-4,15H,11H2,1H3,(H,12,14,16) |
| InChIKey | QRPBYLIRGJREKU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|