C11H10N2O4 — CID 102741872
N-but-3-ynyl-5-hydroxy-2-nitrobenzamide (PubChem CID 102741872) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is N-but-3-ynyl-5-hydroxy-2-nitrobenzamide.
| Compound Name | N-but-3-ynyl-5-hydroxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 102741872 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | N-but-3-ynyl-5-hydroxy-2-nitrobenzamide |
| SMILES | C#CCCNC(=O)c1cc(O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10N2O4/c1-2-3-6-12-11(15)9-7-8(14)4-5-10(9)13(16)17/h1,4-5,7,14H,3,6H2,(H,12,15) |
| InChIKey | OMHODPFANKCTKQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|