C14H16N4O3 — CID 102742448
N-(4-hydroxy-3-methylphenyl)-5-pyrrolidin-2-yl-1,2,4-oxadiazole-3-carboxamide (PubChem CID 102742448) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is N-(4-hydroxy-3-methylphenyl)-5-pyrrolidin-2-yl-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | N-(4-hydroxy-3-methylphenyl)-5-pyrrolidin-2-yl-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 102742448 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | N-(4-hydroxy-3-methylphenyl)-5-pyrrolidin-2-yl-1,2,4-oxadiazole-3-carboxamide |
| SMILES | Cc1cc(NC(=O)c2noc(C3CCCN3)n2)ccc1O |
| InChI | InChI=1S/C14H16N4O3/c1-8-7-9(4-5-11(8)19)16-13(20)12-17-14(21-18-12)10-3-2-6-15-10/h4-5,7,10,15,19H,2-3,6H2,1H3,(H,16,20) |
| InChIKey | BGDAPQHDIWRRAK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 100.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|