C15H25N3O2 — CID 102742804
2-ethoxy-6-(2,2,6,6-tetramethylmorpholin-4-yl)pyridin-3-amine (PubChem CID 102742804) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-ethoxy-6-(2,2,6,6-tetramethylmorpholin-4-yl)pyridin-3-amine.
| Compound Name | 2-ethoxy-6-(2,2,6,6-tetramethylmorpholin-4-yl)pyridin-3-amine |
|---|---|
| PubChem CID | 102742804 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 2-ethoxy-6-(2,2,6,6-tetramethylmorpholin-4-yl)pyridin-3-amine |
| SMILES | CCOc1nc(N2CC(C)(C)OC(C)(C)C2)ccc1N |
| InChI | InChI=1S/C15H25N3O2/c1-6-19-13-11(16)7-8-12(17-13)18-9-14(2,3)20-15(4,5)10-18/h7-8H,6,9-10,16H2,1-5H3 |
| InChIKey | VPFCDEQDXAWCAT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |