C13H21N3O — CID 102742872
3-(2,2,6,6-tetramethylmorpholin-4-yl)pyridin-2-amine (PubChem CID 102742872) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-(2,2,6,6-tetramethylmorpholin-4-yl)pyridin-2-amine.
| Compound Name | 3-(2,2,6,6-tetramethylmorpholin-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 102742872 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 3-(2,2,6,6-tetramethylmorpholin-4-yl)pyridin-2-amine |
| SMILES | CC1(C)CN(c2cccnc2N)CC(C)(C)O1 |
| InChI | InChI=1S/C13H21N3O/c1-12(2)8-16(9-13(3,4)17-12)10-6-5-7-15-11(10)14/h5-7H,8-9H2,1-4H3,(H2,14,15) |
| InChIKey | QPYBBCXCCUSPBY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |