C17H34N2O — CID 102743218
2-cycloheptyl-2-(2,2,6,6-tetramethylmorpholin-4-yl)ethanamine (PubChem CID 102743218) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is 2-cycloheptyl-2-(2,2,6,6-tetramethylmorpholin-4-yl)ethanamine.
| Compound Name | 2-cycloheptyl-2-(2,2,6,6-tetramethylmorpholin-4-yl)ethanamine |
|---|---|
| PubChem CID | 102743218 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 2-cycloheptyl-2-(2,2,6,6-tetramethylmorpholin-4-yl)ethanamine |
| SMILES | CC1(C)CN(C(CN)C2CCCCCC2)CC(C)(C)O1 |
| InChI | InChI=1S/C17H34N2O/c1-16(2)12-19(13-17(3,4)20-16)15(11-18)14-9-7-5-6-8-10-14/h14-15H,5-13,18H2,1-4H3 |
| InChIKey | JRVFPRDQXHWCKS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |