C16H23FN2OS — CID 102743968
4-fluoro-3-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]benzenecarbothioamide (PubChem CID 102743968) has the molecular formula C16H23FN2OS and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-fluoro-3-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]benzenecarbothioamide.
| Compound Name | 4-fluoro-3-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 102743968 |
| Molecular Formula | C16H23FN2OS |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-fluoro-3-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]benzenecarbothioamide |
| SMILES | CC1(C)CN(Cc2cc(C(N)=S)ccc2F)CC(C)(C)O1 |
| InChI | InChI=1S/C16H23FN2OS/c1-15(2)9-19(10-16(3,4)20-15)8-12-7-11(14(18)21)5-6-13(12)17/h5-7H,8-10H2,1-4H3,(H2,18,21) |
| InChIKey | TVJDCLDKIVBENP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|