C15H24N4O — CID 102744106
2-methyl-6-(2,2,6,6-tetramethylmorpholin-4-yl)pyridine-4-carboximidamide (PubChem CID 102744106) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-methyl-6-(2,2,6,6-tetramethylmorpholin-4-yl)pyridine-4-carboximidamide.
| Compound Name | 2-methyl-6-(2,2,6,6-tetramethylmorpholin-4-yl)pyridine-4-carboximidamide |
|---|---|
| PubChem CID | 102744106 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2-methyl-6-(2,2,6,6-tetramethylmorpholin-4-yl)pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C)nc(N2CC(C)(C)OC(C)(C)C2)c1 |
| InChI | InChI=1S/C15H24N4O/c1-10-6-11(13(16)17)7-12(18-10)19-8-14(2,3)20-15(4,5)9-19/h6-7H,8-9H2,1-5H3,(H3,16,17) |
| InChIKey | SVVIJXZEGWHFKG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|