C17H27ClN2O — CID 102744251
1-[2-chloro-4-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]-N-methylethanamine (PubChem CID 102744251) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 1-[2-chloro-4-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]-N-methylethanamine.
| Compound Name | 1-[2-chloro-4-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 102744251 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-[2-chloro-4-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]-N-methylethanamine |
| SMILES | CNC(C)c1ccc(N2CC(C)(C)OC(C)(C)C2)cc1Cl |
| InChI | InChI=1S/C17H27ClN2O/c1-12(19-6)14-8-7-13(9-15(14)18)20-10-16(2,3)21-17(4,5)11-20/h7-9,12,19H,10-11H2,1-6H3 |
| InChIKey | FLNFNJBJKILKOW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|