C14H27N3O — CID 102744291
N'-cyclopentyl-2,2,6,6-tetramethylmorpholine-4-carboximidamide (PubChem CID 102744291) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is N'-cyclopentyl-2,2,6,6-tetramethylmorpholine-4-carboximidamide.
| Compound Name | N'-cyclopentyl-2,2,6,6-tetramethylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 102744291 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | N'-cyclopentyl-2,2,6,6-tetramethylmorpholine-4-carboximidamide |
| SMILES | CC1(C)CN(/C(N)=N/C2CCCC2)CC(C)(C)O1 |
| InChI | InChI=1S/C14H27N3O/c1-13(2)9-17(10-14(3,4)18-13)12(15)16-11-7-5-6-8-11/h11H,5-10H2,1-4H3,(H2,15,16) |
| InChIKey | MHFXVVICPXIBPB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|