C11H23N3O — CID 102744292
N'-ethyl-2,2,6,6-tetramethylmorpholine-4-carboximidamide (PubChem CID 102744292) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is N'-ethyl-2,2,6,6-tetramethylmorpholine-4-carboximidamide.
| Compound Name | N'-ethyl-2,2,6,6-tetramethylmorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 102744292 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | N'-ethyl-2,2,6,6-tetramethylmorpholine-4-carboximidamide |
| SMILES | CC/N=C(\N)N1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C11H23N3O/c1-6-13-9(12)14-7-10(2,3)15-11(4,5)8-14/h6-8H2,1-5H3,(H2,12,13) |
| InChIKey | LDCHQXXTQVLHFA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|