C16H25NO2 — CID 102744671
(1R)-1-[2-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]ethanol (PubChem CID 102744671) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is (1R)-1-[2-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]ethanol.
| Compound Name | (1R)-1-[2-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 102744671 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (1R)-1-[2-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]ethanol |
| SMILES | C[C@@H](O)c1ccccc1N1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C16H25NO2/c1-12(18)13-8-6-7-9-14(13)17-10-15(2,3)19-16(4,5)11-17/h6-9,12,18H,10-11H2,1-5H3/t12-/m1/s1 |
| InChIKey | GJFFWVLQPOXJRF-GFCCVEGCSA-N |
| XLogP | 3.13 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |