C18H30N2O — CID 102744803
N-[[3-methyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]methyl]ethanamine (PubChem CID 102744803) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is N-[[3-methyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]methyl]ethanamine.
| Compound Name | N-[[3-methyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 102744803 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | N-[[3-methyl-4-(2,2,6,6-tetramethylmorpholin-4-yl)phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(N2CC(C)(C)OC(C)(C)C2)c(C)c1 |
| InChI | InChI=1S/C18H30N2O/c1-7-19-11-15-8-9-16(14(2)10-15)20-12-17(3,4)21-18(5,6)13-20/h8-10,19H,7,11-13H2,1-6H3 |
| InChIKey | SHZHFDWBHKJUTP-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|