C13H22N3O2+ — CID 102744998
(3-methylimidazol-3-ium-1-yl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone (PubChem CID 102744998) has the molecular formula C13H22N3O2+ and a molecular weight of 252.34 g/mol. Its IUPAC name is (3-methylimidazol-3-ium-1-yl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone.
| Compound Name | (3-methylimidazol-3-ium-1-yl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 102744998 |
| Molecular Formula | C13H22N3O2+ |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3-methylimidazol-3-ium-1-yl)-(2,2,6,6-tetramethylmorpholin-4-yl)methanone |
| SMILES | C[n+]1ccn(C(=O)N2CC(C)(C)OC(C)(C)C2)c1 |
| InChI | InChI=1S/C13H22N3O2/c1-12(2)8-16(9-13(3,4)18-12)11(17)15-7-6-14(5)10-15/h6-7,10H,8-9H2,1-5H3/q+1 |
| InChIKey | HGLBPZPIQQKLDV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 38.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|