C15H27NO4 — CID 102745109
3,3-dimethyl-2-(2,2,6,6-tetramethylmorpholine-4-carbonyl)butanoic acid (PubChem CID 102745109) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is 3,3-dimethyl-2-(2,2,6,6-tetramethylmorpholine-4-carbonyl)butanoic acid.
| Compound Name | 3,3-dimethyl-2-(2,2,6,6-tetramethylmorpholine-4-carbonyl)butanoic acid |
|---|---|
| PubChem CID | 102745109 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 3,3-dimethyl-2-(2,2,6,6-tetramethylmorpholine-4-carbonyl)butanoic acid |
| SMILES | CC1(C)CN(C(=O)C(C(=O)O)C(C)(C)C)CC(C)(C)O1 |
| InChI | InChI=1S/C15H27NO4/c1-13(2,3)10(12(18)19)11(17)16-8-14(4,5)20-15(6,7)9-16/h10H,8-9H2,1-7H3,(H,18,19) |
| InChIKey | JFBSMPUBEBQCCB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|