C16H22N2O2S — CID 102745174
[3-(3-aminoprop-1-ynyl)thiophen-2-yl]-(2,2,6,6-tetramethylmorpholin-4-yl)methanone (PubChem CID 102745174) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is [3-(3-aminoprop-1-ynyl)thiophen-2-yl]-(2,2,6,6-tetramethylmorpholin-4-yl)methanone.
| Compound Name | [3-(3-aminoprop-1-ynyl)thiophen-2-yl]-(2,2,6,6-tetramethylmorpholin-4-yl)methanone |
|---|---|
| PubChem CID | 102745174 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | [3-(3-aminoprop-1-ynyl)thiophen-2-yl]-(2,2,6,6-tetramethylmorpholin-4-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2sccc2C#CCN)CC(C)(C)O1 |
| InChI | InChI=1S/C16H22N2O2S/c1-15(2)10-18(11-16(3,4)20-15)14(19)13-12(6-5-8-17)7-9-21-13/h7,9H,8,10-11,17H2,1-4H3 |
| InChIKey | GPHQKOLDYLXLCS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|