C17H27ClN2O — CID 102745239
4-[4-(chloromethyl)-6-propyl-2-pyridinyl]-2,2,6,6-tetramethylmorpholine (PubChem CID 102745239) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 4-[4-(chloromethyl)-6-propyl-2-pyridinyl]-2,2,6,6-tetramethylmorpholine.
| Compound Name | 4-[4-(chloromethyl)-6-propyl-2-pyridinyl]-2,2,6,6-tetramethylmorpholine |
|---|---|
| PubChem CID | 102745239 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 4-[4-(chloromethyl)-6-propyl-2-pyridinyl]-2,2,6,6-tetramethylmorpholine |
| SMILES | CCCc1cc(CCl)cc(N2CC(C)(C)OC(C)(C)C2)n1 |
| InChI | InChI=1S/C17H27ClN2O/c1-6-7-14-8-13(10-18)9-15(19-14)20-11-16(2,3)21-17(4,5)12-20/h8-9H,6-7,10-12H2,1-5H3 |
| InChIKey | BOQCHPQUIOLKFL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|