About (3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol
(3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol (PubChem CID 10274545) has the molecular formula C22H20F2O5S
and a molecular weight of 434.46 g/mol. Its IUPAC name is (3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol.
Molecular Properties
| Compound Name | (3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol |
| PubChem CID | 10274545 |
| Molecular Formula | C22H20F2O5S |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | (3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol |
| SMILES | COc1cc(-c2ccc(S(C)(=O)=O)cc2)c(C(O)c2cc(F)cc(F)c2)cc1OC |
| InChI | InChI=1S/C22H20F2O5S/c1-28-20-11-18(13-4-6-17(7-5-13)30(3,26)27)19(12-21(20)29-2)22(25)14-8-15(23)10-16(24)9-14/h4-12,22,25H,1-3H3 |
| InChIKey | AGUFMRBMPCCPHQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol?
The IUPAC name of (3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol (CID 10274545) is (3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol.
What is the SMILES notation for (3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol?
The canonical SMILES for (3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol is COc1cc(-c2ccc(S(C)(=O)=O)cc2)c(C(O)c2cc(F)cc(F)c2)cc1OC.
What is the InChIKey of (3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol?
The InChIKey is AGUFMRBMPCCPHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F2O5S/c1-28-20-11-18(13-4-6-17(7-5-13)30(3,26)27)19(12-21(20)29-2)22(25)14-8-15(23)10-16(24)9-14/h4-12,22,25H,1-3H3.
What are the key properties of (3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol?
(3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol has a molecular weight of 434.46 g/mol, XLogP of 4.13, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-difluorophenyl)-[4,5-dimethoxy-2-(4-methylsulfonylphenyl)phenyl]methanol is sourced from PubChem (CID 10274545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).