C17H34N2O2 — CID 102745744
2,2,5,5-tetramethyl-4-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]oxolan-3-amine (PubChem CID 102745744) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-4-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]oxolan-3-amine.
| Compound Name | 2,2,5,5-tetramethyl-4-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 102745744 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | 2,2,5,5-tetramethyl-4-[(2,2,6,6-tetramethylmorpholin-4-yl)methyl]oxolan-3-amine |
| SMILES | CC1(C)CN(CC2C(N)C(C)(C)OC2(C)C)CC(C)(C)O1 |
| InChI | InChI=1S/C17H34N2O2/c1-14(2)10-19(11-15(3,4)20-14)9-12-13(18)17(7,8)21-16(12,5)6/h12-13H,9-11,18H2,1-8H3 |
| InChIKey | HTIFMYQHSKQHQM-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |