C23H28F3N3O2 — CID 10274635
4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]morpholin-3-one (PubChem CID 10274635) has the molecular formula C23H28F3N3O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is 4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]morpholin-3-one.
| Compound Name | 4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]morpholin-3-one |
|---|---|
| PubChem CID | 10274635 |
| Molecular Formula | C23H28F3N3O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 4-[2-[(4aR,11R,11aS)-11-methyl-9-(trifluoromethyl)-1,3,4,4a,5,6,11,11a-octahydropyrido[4,3-b]carbazol-2-yl]ethyl]morpholin-3-one |
| SMILES | C[C@H]1c2c([nH]c3ccc(C(F)(F)F)cc23)C[C@H]2CCN(CCN3CCOCC3=O)C[C@@H]21 |
| InChI | InChI=1S/C23H28F3N3O2/c1-14-18-12-28(6-7-29-8-9-31-13-21(29)30)5-4-15(18)10-20-22(14)17-11-16(23(24,25)26)2-3-19(17)27-20/h2-3,11,14-15,18,27H,4-10,12-13H2,1H3/t14-,15-,18-/m1/s1 |
| InChIKey | YFWHVNXTRQFUSK-IIDMSEBBSA-N |
| XLogP | 3.64 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|