C16H24BrNO2 — CID 102746762
4-bromo-2-[1-(2,2,6,6-tetramethylmorpholin-4-yl)ethyl]phenol (PubChem CID 102746762) has the molecular formula C16H24BrNO2 and a molecular weight of 342.28 g/mol. Its IUPAC name is 4-bromo-2-[1-(2,2,6,6-tetramethylmorpholin-4-yl)ethyl]phenol.
| Compound Name | 4-bromo-2-[1-(2,2,6,6-tetramethylmorpholin-4-yl)ethyl]phenol |
|---|---|
| PubChem CID | 102746762 |
| Molecular Formula | C16H24BrNO2 |
| Molecular Weight | 342.28 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 4-bromo-2-[1-(2,2,6,6-tetramethylmorpholin-4-yl)ethyl]phenol |
| SMILES | CC(c1cc(Br)ccc1O)N1CC(C)(C)OC(C)(C)C1 |
| InChI | InChI=1S/C16H24BrNO2/c1-11(13-8-12(17)6-7-14(13)19)18-9-15(2,3)20-16(4,5)10-18/h6-8,11,19H,9-10H2,1-5H3 |
| InChIKey | GDTPCNAOKYHACR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|