C12H17NO4S2 — CID 102747498
4-methyl-3-(3-methylpiperidin-1-yl)sulfonylthiophene-2-carboxylic acid (PubChem CID 102747498) has the molecular formula C12H17NO4S2 and a molecular weight of 303.40 g/mol. Its IUPAC name is 4-methyl-3-(3-methylpiperidin-1-yl)sulfonylthiophene-2-carboxylic acid.
| Compound Name | 4-methyl-3-(3-methylpiperidin-1-yl)sulfonylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102747498 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 4-methyl-3-(3-methylpiperidin-1-yl)sulfonylthiophene-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)O)c1S(=O)(=O)N1CCCC(C)C1 |
| InChI | InChI=1S/C12H17NO4S2/c1-8-4-3-5-13(6-8)19(16,17)11-9(2)7-18-10(11)12(14)15/h7-8H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | LNEJTTRARUSHRZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |