C13H11F4N3O — CID 102747880
5-ethyl-6-[4-fluoro-3-(trifluoromethyl)phenoxy]pyrimidin-4-amine (PubChem CID 102747880) has the molecular formula C13H11F4N3O and a molecular weight of 301.24 g/mol. Its IUPAC name is 5-ethyl-6-[4-fluoro-3-(trifluoromethyl)phenoxy]pyrimidin-4-amine.
| Compound Name | 5-ethyl-6-[4-fluoro-3-(trifluoromethyl)phenoxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 102747880 |
| Molecular Formula | C13H11F4N3O |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 5-ethyl-6-[4-fluoro-3-(trifluoromethyl)phenoxy]pyrimidin-4-amine |
| SMILES | CCc1c(N)ncnc1Oc1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F4N3O/c1-2-8-11(18)19-6-20-12(8)21-7-3-4-10(14)9(5-7)13(15,16)17/h3-6H,2H2,1H3,(H2,18,19,20) |
| InChIKey | NYWXYOAJZCLLDA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |