C11H8N2O4S3 — CID 102747957
3-[(3-cyanothiophen-2-yl)sulfamoyl]-4-methylthiophene-2-carboxylic acid (PubChem CID 102747957) has the molecular formula C11H8N2O4S3 and a molecular weight of 328.40 g/mol. Its IUPAC name is 3-[(3-cyanothiophen-2-yl)sulfamoyl]-4-methylthiophene-2-carboxylic acid.
| Compound Name | 3-[(3-cyanothiophen-2-yl)sulfamoyl]-4-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102747957 |
| Molecular Formula | C11H8N2O4S3 |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 3-[(3-cyanothiophen-2-yl)sulfamoyl]-4-methylthiophene-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)O)c1S(=O)(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C11H8N2O4S3/c1-6-5-19-8(11(14)15)9(6)20(16,17)13-10-7(4-12)2-3-18-10/h2-3,5,13H,1H3,(H,14,15) |
| InChIKey | JYJNRPKMXIZMRB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |