About methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate
methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate (PubChem CID 102749094) has the molecular formula C10H12N4O4S2
and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate |
| PubChem CID | 102749094 |
| Molecular Formula | C10H12N4O4S2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1scc(C)c1S(=O)(=O)Nc1ncnn1C |
| InChI | InChI=1S/C10H12N4O4S2/c1-6-4-19-7(9(15)18-3)8(6)20(16,17)13-10-11-5-12-14(10)2/h4-5H,1-3H3,(H,11,12,13) |
| InChIKey | IJTPDXFDJMMKAW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate?
The IUPAC name of methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate (CID 102749094) is methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate.
What is the SMILES notation for methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate?
The canonical SMILES for methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate is COC(=O)c1scc(C)c1S(=O)(=O)Nc1ncnn1C.
What is the InChIKey of methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate?
The InChIKey is IJTPDXFDJMMKAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O4S2/c1-6-4-19-7(9(15)18-3)8(6)20(16,17)13-10-11-5-12-14(10)2/h4-5H,1-3H3,(H,11,12,13).
What are the key properties of methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate?
methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate has a molecular weight of 316.36 g/mol, XLogP of 0.77, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)sulfamoyl]thiophene-2-carboxylate is sourced from PubChem (CID 102749094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).