C10H9N3O5S2 — CID 102749443
4-methyl-3-[(6-oxo-1H-pyridazin-3-yl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 102749443) has the molecular formula C10H9N3O5S2 and a molecular weight of 315.33 g/mol. Its IUPAC name is 4-methyl-3-[(6-oxo-1H-pyridazin-3-yl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 4-methyl-3-[(6-oxo-1H-pyridazin-3-yl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102749443 |
| Molecular Formula | C10H9N3O5S2 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 4-methyl-3-[(6-oxo-1H-pyridazin-3-yl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | Cc1csc(C(=O)O)c1S(=O)(=O)Nc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C10H9N3O5S2/c1-5-4-19-8(10(15)16)9(5)20(17,18)13-6-2-3-7(14)12-11-6/h2-4H,1H3,(H,11,13)(H,12,14)(H,15,16) |
| InChIKey | LYQXMOMSRMKSQD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 129.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |