C10H13ClF3NO2S2 — CID 102750712
2-(chloromethyl)-N,4-dimethyl-N-(3,3,3-trifluoropropyl)thiophene-3-sulfonamide (PubChem CID 102750712) has the molecular formula C10H13ClF3NO2S2 and a molecular weight of 335.80 g/mol. Its IUPAC name is 2-(chloromethyl)-N,4-dimethyl-N-(3,3,3-trifluoropropyl)thiophene-3-sulfonamide.
| Compound Name | 2-(chloromethyl)-N,4-dimethyl-N-(3,3,3-trifluoropropyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 102750712 |
| Molecular Formula | C10H13ClF3NO2S2 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 2-(chloromethyl)-N,4-dimethyl-N-(3,3,3-trifluoropropyl)thiophene-3-sulfonamide |
| SMILES | Cc1csc(CCl)c1S(=O)(=O)N(C)CCC(F)(F)F |
| InChI | InChI=1S/C10H13ClF3NO2S2/c1-7-6-18-8(5-11)9(7)19(16,17)15(2)4-3-10(12,13)14/h6H,3-5H2,1-2H3 |
| InChIKey | XIVBAYHKRNFXRD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|