C12H15ClF3NO2S2 — CID 102750714
1-[2-(chloromethyl)-4-methylthiophen-3-yl]sulfonyl-4-(trifluoromethyl)piperidine (PubChem CID 102750714) has the molecular formula C12H15ClF3NO2S2 and a molecular weight of 361.84 g/mol. Its IUPAC name is 1-[2-(chloromethyl)-4-methylthiophen-3-yl]sulfonyl-4-(trifluoromethyl)piperidine.
| Compound Name | 1-[2-(chloromethyl)-4-methylthiophen-3-yl]sulfonyl-4-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 102750714 |
| Molecular Formula | C12H15ClF3NO2S2 |
| Molecular Weight | 361.84 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 1-[2-(chloromethyl)-4-methylthiophen-3-yl]sulfonyl-4-(trifluoromethyl)piperidine |
| SMILES | Cc1csc(CCl)c1S(=O)(=O)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H15ClF3NO2S2/c1-8-7-20-10(6-13)11(8)21(18,19)17-4-2-9(3-5-17)12(14,15)16/h7,9H,2-6H2,1H3 |
| InChIKey | GZNFBBKWTOHNNP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.84 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|