C13H9Cl3F2N2 — CID 102750989
3,5,6-trichloro-N-[2-(3,5-difluorophenyl)ethyl]pyridin-2-amine (PubChem CID 102750989) has the molecular formula C13H9Cl3F2N2 and a molecular weight of 337.58 g/mol. Its IUPAC name is 3,5,6-trichloro-N-[2-(3,5-difluorophenyl)ethyl]pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-[2-(3,5-difluorophenyl)ethyl]pyridin-2-amine |
|---|---|
| PubChem CID | 102750989 |
| Molecular Formula | C13H9Cl3F2N2 |
| Molecular Weight | 337.58 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 3,5,6-trichloro-N-[2-(3,5-difluorophenyl)ethyl]pyridin-2-amine |
| SMILES | Fc1cc(F)cc(CCNc2nc(Cl)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H9Cl3F2N2/c14-10-6-11(15)13(20-12(10)16)19-2-1-7-3-8(17)5-9(18)4-7/h3-6H,1-2H2,(H,19,20) |
| InChIKey | CBXLOHIVGATZOR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|