C14H11Cl3N2O — CID 102751070
4-(3,5,6-trichloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine (PubChem CID 102751070) has the molecular formula C14H11Cl3N2O and a molecular weight of 329.61 g/mol. Its IUPAC name is 4-(3,5,6-trichloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine.
| Compound Name | 4-(3,5,6-trichloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine |
|---|---|
| PubChem CID | 102751070 |
| Molecular Formula | C14H11Cl3N2O |
| Molecular Weight | 329.61 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 4-(3,5,6-trichloro-2-pyridinyl)-3,5-dihydro-2H-1,4-benzoxazepine |
| SMILES | Clc1cc(Cl)c(N2CCOc3ccccc3C2)nc1Cl |
| InChI | InChI=1S/C14H11Cl3N2O/c15-10-7-11(16)14(18-13(10)17)19-5-6-20-12-4-2-1-3-9(12)8-19/h1-4,7H,5-6,8H2 |
| InChIKey | PFZGKEJIFQVREB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|