C7H5Cl3F2N2 — CID 102751640
3,5,6-trichloro-N-(2,2-difluoroethyl)pyridin-2-amine (PubChem CID 102751640) has the molecular formula C7H5Cl3F2N2 and a molecular weight of 261.49 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(2,2-difluoroethyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(2,2-difluoroethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102751640 |
| Molecular Formula | C7H5Cl3F2N2 |
| Molecular Weight | 261.49 g/mol |
| Exact Mass | 259.95 |
| IUPAC Name | 3,5,6-trichloro-N-(2,2-difluoroethyl)pyridin-2-amine |
| SMILES | FC(F)CNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C7H5Cl3F2N2/c8-3-1-4(9)7(14-6(3)10)13-2-5(11)12/h1,5H,2H2,(H,13,14) |
| InChIKey | KHSLGWBLKHNDQN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|