C9H8Cl3F3N2 — CID 102751644
3,5,6-trichloro-N-(4,4,4-trifluorobutyl)pyridin-2-amine (PubChem CID 102751644) has the molecular formula C9H8Cl3F3N2 and a molecular weight of 307.53 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(4,4,4-trifluorobutyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(4,4,4-trifluorobutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102751644 |
| Molecular Formula | C9H8Cl3F3N2 |
| Molecular Weight | 307.53 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 3,5,6-trichloro-N-(4,4,4-trifluorobutyl)pyridin-2-amine |
| SMILES | FC(F)(F)CCCNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H8Cl3F3N2/c10-5-4-6(11)8(17-7(5)12)16-3-1-2-9(13,14)15/h4H,1-3H2,(H,16,17) |
| InChIKey | MVKGXVWXFWGACR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|