C10H10Cl3F3N2 — CID 102751645
3,5,6-trichloro-N-(5,5,5-trifluoropentyl)pyridin-2-amine (PubChem CID 102751645) has the molecular formula C10H10Cl3F3N2 and a molecular weight of 321.56 g/mol. Its IUPAC name is 3,5,6-trichloro-N-(5,5,5-trifluoropentyl)pyridin-2-amine.
| Compound Name | 3,5,6-trichloro-N-(5,5,5-trifluoropentyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102751645 |
| Molecular Formula | C10H10Cl3F3N2 |
| Molecular Weight | 321.56 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 3,5,6-trichloro-N-(5,5,5-trifluoropentyl)pyridin-2-amine |
| SMILES | FC(F)(F)CCCCNc1nc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl3F3N2/c11-6-5-7(12)9(18-8(6)13)17-4-2-1-3-10(14,15)16/h5H,1-4H2,(H,17,18) |
| InChIKey | ORMVFNPOXBEFBC-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|