C12H19F3N2O2S2 — CID 102751800
N,4-dimethyl-2-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)thiophene-3-sulfonamide (PubChem CID 102751800) has the molecular formula C12H19F3N2O2S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is N,4-dimethyl-2-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)thiophene-3-sulfonamide.
| Compound Name | N,4-dimethyl-2-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 102751800 |
| Molecular Formula | C12H19F3N2O2S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N,4-dimethyl-2-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)thiophene-3-sulfonamide |
| SMILES | CCCNCc1scc(C)c1S(=O)(=O)N(C)CC(F)(F)F |
| InChI | InChI=1S/C12H19F3N2O2S2/c1-4-5-16-6-10-11(9(2)7-20-10)21(18,19)17(3)8-12(13,14)15/h7,16H,4-6,8H2,1-3H3 |
| InChIKey | OQGHSANRZFBPAV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|