C12H22N2O2S2 — CID 102751963
4-methyl-N-propan-2-yl-2-(propylaminomethyl)thiophene-3-sulfonamide (PubChem CID 102751963) has the molecular formula C12H22N2O2S2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 4-methyl-N-propan-2-yl-2-(propylaminomethyl)thiophene-3-sulfonamide.
| Compound Name | 4-methyl-N-propan-2-yl-2-(propylaminomethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 102751963 |
| Molecular Formula | C12H22N2O2S2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-methyl-N-propan-2-yl-2-(propylaminomethyl)thiophene-3-sulfonamide |
| SMILES | CCCNCc1scc(C)c1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C12H22N2O2S2/c1-5-6-13-7-11-12(10(4)8-17-11)18(15,16)14-9(2)3/h8-9,13-14H,5-7H2,1-4H3 |
| InChIKey | PSQOCEREFJGZLL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|