C17H14BrCl2N3O2 — CID 10275200
5-[(4-bromophenyl)methyl]-3-(2,6-dichloro-4-pyridinyl)-1,5-dimethylimidazolidine-2,4-dione (PubChem CID 10275200) has the molecular formula C17H14BrCl2N3O2 and a molecular weight of 443.13 g/mol. Its IUPAC name is 5-[(4-bromophenyl)methyl]-3-(2,6-dichloro-4-pyridinyl)-1,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 5-[(4-bromophenyl)methyl]-3-(2,6-dichloro-4-pyridinyl)-1,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10275200 |
| Molecular Formula | C17H14BrCl2N3O2 |
| Molecular Weight | 443.13 g/mol |
| Exact Mass | 440.96 |
| IUPAC Name | 5-[(4-bromophenyl)methyl]-3-(2,6-dichloro-4-pyridinyl)-1,5-dimethylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)N(c2cc(Cl)nc(Cl)c2)C(=O)C1(C)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H14BrCl2N3O2/c1-17(9-10-3-5-11(18)6-4-10)15(24)23(16(25)22(17)2)12-7-13(19)21-14(20)8-12/h3-8H,9H2,1-2H3 |
| InChIKey | HUPYYYHFRCJCSN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.13 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|