C19H25F4N7O — CID 10275212
6-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-4-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 10275212) has the molecular formula C19H25F4N7O and a molecular weight of 443.45 g/mol. Its IUPAC name is 6-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-4-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-4-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 10275212 |
| Molecular Formula | C19H25F4N7O |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 6-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-4-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN1CCCC1CNc1nc(NCC(F)(F)F)nc(Nc2ccc(OC)c(F)c2)n1 |
| InChI | InChI=1S/C19H25F4N7O/c1-3-30-8-4-5-13(30)10-24-16-27-17(25-11-19(21,22)23)29-18(28-16)26-12-6-7-15(31-2)14(20)9-12/h6-7,9,13H,3-5,8,10-11H2,1-2H3,(H3,24,25,26,27,28,29) |
| InChIKey | XCZHXJKHWMQOJE-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |