C26H28N4O3 — CID 10275297
4-N-benzyl-6,7-dimethoxy-2-N-[2-(3-methoxyphenyl)ethyl]quinazoline-2,4-diamine (PubChem CID 10275297) has the molecular formula C26H28N4O3 and a molecular weight of 444.54 g/mol. Its IUPAC name is 4-N-benzyl-6,7-dimethoxy-2-N-[2-(3-methoxyphenyl)ethyl]quinazoline-2,4-diamine.
| Compound Name | 4-N-benzyl-6,7-dimethoxy-2-N-[2-(3-methoxyphenyl)ethyl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 10275297 |
| Molecular Formula | C26H28N4O3 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | 4-N-benzyl-6,7-dimethoxy-2-N-[2-(3-methoxyphenyl)ethyl]quinazoline-2,4-diamine |
| SMILES | COc1cccc(CCNc2nc(NCc3ccccc3)c3cc(OC)c(OC)cc3n2)c1 |
| InChI | InChI=1S/C26H28N4O3/c1-31-20-11-7-10-18(14-20)12-13-27-26-29-22-16-24(33-3)23(32-2)15-21(22)25(30-26)28-17-19-8-5-4-6-9-19/h4-11,14-16H,12-13,17H2,1-3H3,(H2,27,28,29,30) |
| InChIKey | JQXXGZCNNKFGTR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |