About 3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea
3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea (PubChem CID 10275303) has the molecular formula C20H30F2N4O3S
and a molecular weight of 444.55 g/mol. Its IUPAC name is 3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea.
Molecular Properties
| Compound Name | 3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea |
| PubChem CID | 10275303 |
| Molecular Formula | C20H30F2N4O3S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea |
| SMILES | CCS(=O)(=O)N1CCC(N(C)C(=O)NC2CCN(c3cc(F)cc(F)c3)CC2)CC1 |
| InChI | InChI=1S/C20H30F2N4O3S/c1-3-30(28,29)26-10-6-18(7-11-26)24(2)20(27)23-17-4-8-25(9-5-17)19-13-15(21)12-16(22)14-19/h12-14,17-18H,3-11H2,1-2H3,(H,23,27) |
| InChIKey | COKGNASNCZQRRM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea?
The IUPAC name of 3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea (CID 10275303) is 3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea.
What is the SMILES notation for 3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea?
The canonical SMILES for 3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea is CCS(=O)(=O)N1CCC(N(C)C(=O)NC2CCN(c3cc(F)cc(F)c3)CC2)CC1.
What is the InChIKey of 3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea?
The InChIKey is COKGNASNCZQRRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30F2N4O3S/c1-3-30(28,29)26-10-6-18(7-11-26)24(2)20(27)23-17-4-8-25(9-5-17)19-13-15(21)12-16(22)14-19/h12-14,17-18H,3-11H2,1-2H3,(H,23,27).
What are the key properties of 3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea?
3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea has a molecular weight of 444.55 g/mol, XLogP of 2.39, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-(3,5-difluorophenyl)piperidin-4-yl]-1-(1-ethylsulfonylpiperidin-4-yl)-1-methylurea is sourced from PubChem (CID 10275303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).