C9H5BrCl2N2O — CID 102753401
6-(3-bromofuran-2-yl)-3,5-dichloropyridin-2-amine (PubChem CID 102753401) has the molecular formula C9H5BrCl2N2O and a molecular weight of 307.96 g/mol. Its IUPAC name is 6-(3-bromofuran-2-yl)-3,5-dichloropyridin-2-amine.
| Compound Name | 6-(3-bromofuran-2-yl)-3,5-dichloropyridin-2-amine |
|---|---|
| PubChem CID | 102753401 |
| Molecular Formula | C9H5BrCl2N2O |
| Molecular Weight | 307.96 g/mol |
| Exact Mass | 305.90 |
| IUPAC Name | 6-(3-bromofuran-2-yl)-3,5-dichloropyridin-2-amine |
| SMILES | Nc1nc(-c2occc2Br)c(Cl)cc1Cl |
| InChI | InChI=1S/C9H5BrCl2N2O/c10-4-1-2-15-8(4)7-5(11)3-6(12)9(13)14-7/h1-3H,(H2,13,14) |
| InChIKey | ULOIOEOFIVRVQM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.96 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |