C16H22F3NO — CID 102754281
N-[[2-methyl-4-(trifluoromethyl)phenyl]-(oxolan-3-yl)methyl]propan-1-amine (PubChem CID 102754281) has the molecular formula C16H22F3NO and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[[2-methyl-4-(trifluoromethyl)phenyl]-(oxolan-3-yl)methyl]propan-1-amine.
| Compound Name | N-[[2-methyl-4-(trifluoromethyl)phenyl]-(oxolan-3-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 102754281 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-[[2-methyl-4-(trifluoromethyl)phenyl]-(oxolan-3-yl)methyl]propan-1-amine |
| SMILES | CCCNC(c1ccc(C(F)(F)F)cc1C)C1CCOC1 |
| InChI | InChI=1S/C16H22F3NO/c1-3-7-20-15(12-6-8-21-10-12)14-5-4-13(9-11(14)2)16(17,18)19/h4-5,9,12,15,20H,3,6-8,10H2,1-2H3 |
| InChIKey | ZISFGJOQOHHKLA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |