C27H22N6O — CID 10275431
2-[[1-methyl-3-[[3-(2H-tetrazol-5-yl)phenyl]methyl]indol-5-yl]oxymethyl]quinoline (PubChem CID 10275431) has the molecular formula C27H22N6O and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-[[1-methyl-3-[[3-(2H-tetrazol-5-yl)phenyl]methyl]indol-5-yl]oxymethyl]quinoline.
| Compound Name | 2-[[1-methyl-3-[[3-(2H-tetrazol-5-yl)phenyl]methyl]indol-5-yl]oxymethyl]quinoline |
|---|---|
| PubChem CID | 10275431 |
| Molecular Formula | C27H22N6O |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 2-[[1-methyl-3-[[3-(2H-tetrazol-5-yl)phenyl]methyl]indol-5-yl]oxymethyl]quinoline |
| SMILES | Cn1cc(Cc2cccc(-c3nn[nH]n3)c2)c2cc(OCc3ccc4ccccc4n3)ccc21 |
| InChI | InChI=1S/C27H22N6O/c1-33-16-21(14-18-5-4-7-20(13-18)27-29-31-32-30-27)24-15-23(11-12-26(24)33)34-17-22-10-9-19-6-2-3-8-25(19)28-22/h2-13,15-16H,14,17H2,1H3,(H,29,30,31,32) |
| InChIKey | KUZALXUPGGNAOM-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |