C24H35NO7 — CID 10275637
[(1R,2R,6S,8S,10S,11R,12S)-12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl] heptanoate (PubChem CID 10275637) has the molecular formula C24H35NO7 and a molecular weight of 449.54 g/mol. Its IUPAC name is [(1R,2R,6S,8S,10S,11R,12S)-12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl] heptanoate.
| Compound Name | [(1R,2R,6S,8S,10S,11R,12S)-12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl] heptanoate |
|---|---|
| PubChem CID | 10275637 |
| Molecular Formula | C24H35NO7 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | [(1R,2R,6S,8S,10S,11R,12S)-12-(dimethylamino)-3,8-dimethyl-4,14-dioxo-5,9,15-trioxatetracyclo[11.2.1.02,6.08,10]hexadec-13(16)-en-11-yl] heptanoate |
| SMILES | CCCCCCC(=O)O[C@@H]1[C@@H](N(C)C)C2=C[C@@H](OC2=O)[C@@H]2C(C)C(=O)O[C@H]2C[C@]2(C)O[C@@H]12 |
| InChI | InChI=1S/C24H35NO7/c1-6-7-8-9-10-17(26)31-20-19(25(4)5)14-11-15(29-23(14)28)18-13(2)22(27)30-16(18)12-24(3)21(20)32-24/h11,13,15-16,18-21H,6-10,12H2,1-5H3/t13?,15-,16+,18+,19+,20-,21+,24+/m1/s1 |
| InChIKey | NURAEYYRLCNYRK-BWJQZDGISA-N |
| XLogP | 2.39 |
| TPSA | 94.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|