C15H17F4N — CID 102756584
3-fluoro-3-[2-methyl-4-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]octane (PubChem CID 102756584) has the molecular formula C15H17F4N and a molecular weight of 287.30 g/mol. Its IUPAC name is 3-fluoro-3-[2-methyl-4-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-fluoro-3-[2-methyl-4-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 102756584 |
| Molecular Formula | C15H17F4N |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 3-fluoro-3-[2-methyl-4-(trifluoromethyl)phenyl]-8-azabicyclo[3.2.1]octane |
| SMILES | Cc1cc(C(F)(F)F)ccc1C1(F)CC2CCC(C1)N2 |
| InChI | InChI=1S/C15H17F4N/c1-9-6-10(15(17,18)19)2-5-13(9)14(16)7-11-3-4-12(8-14)20-11/h2,5-6,11-12,20H,3-4,7-8H2,1H3 |
| InChIKey | DWMFKBNBFCIDQX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |