C12H17Cl2N3O — CID 102756606
3,5-dichloro-6-(5-ethyl-2-methylmorpholin-4-yl)pyridin-2-amine (PubChem CID 102756606) has the molecular formula C12H17Cl2N3O and a molecular weight of 290.19 g/mol. Its IUPAC name is 3,5-dichloro-6-(5-ethyl-2-methylmorpholin-4-yl)pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-(5-ethyl-2-methylmorpholin-4-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 102756606 |
| Molecular Formula | C12H17Cl2N3O |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 3,5-dichloro-6-(5-ethyl-2-methylmorpholin-4-yl)pyridin-2-amine |
| SMILES | CCC1COC(C)CN1c1nc(N)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2N3O/c1-3-8-6-18-7(2)5-17(8)12-10(14)4-9(13)11(15)16-12/h4,7-8H,3,5-6H2,1-2H3,(H2,15,16) |
| InChIKey | SVPVYERWUIESHN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |